C36H71NO2 — CID 155163843
[(Z)-9-octylicos-14-en-10-yl] 6-(dimethylamino)hexanoate (PubChem CID 155163843) has the molecular formula C36H71NO2 and a molecular weight of 549.97 g/mol. Its IUPAC name is [(Z)-9-octylicos-14-en-10-yl] 6-(dimethylamino)hexanoate.
| Compound Name | [(Z)-9-octylicos-14-en-10-yl] 6-(dimethylamino)hexanoate |
|---|---|
| PubChem CID | 155163843 |
| Molecular Formula | C36H71NO2 |
| Molecular Weight | 549.97 g/mol |
| Exact Mass | 549.55 |
| IUPAC Name | [(Z)-9-octylicos-14-en-10-yl] 6-(dimethylamino)hexanoate |
| SMILES | CCCCC/C=C\CCCC(OC(=O)CCCCCN(C)C)C(CCCCCCCC)CCCCCCCC |
| InChI | InChI=1S/C36H71NO2/c1-6-9-12-15-18-19-22-26-31-35(39-36(38)32-27-23-28-33-37(4)5)34(29-24-20-16-13-10-7-2)30-25-21-17-14-11-8-3/h18-19,34-35H,6-17,20-33H2,1-5H3/b19-18- |
| InChIKey | HSZVTJNMWJZTGT-HNENSFHCSA-N |
| XLogP | 11.44 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.97 |
| LogP ≤ 5 | 11.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|