C34H65NO4 — CID 71815262
[(Z)-non-2-enyl] 10-[4-(dimethylamino)butanoyloxy]nonadecanoate (PubChem CID 71815262) has the molecular formula C34H65NO4 and a molecular weight of 551.90 g/mol. Its IUPAC name is [(Z)-non-2-enyl] 10-[4-(dimethylamino)butanoyloxy]nonadecanoate.
| Compound Name | [(Z)-non-2-enyl] 10-[4-(dimethylamino)butanoyloxy]nonadecanoate |
|---|---|
| PubChem CID | 71815262 |
| Molecular Formula | C34H65NO4 |
| Molecular Weight | 551.90 g/mol |
| Exact Mass | 551.49 |
| IUPAC Name | [(Z)-non-2-enyl] 10-[4-(dimethylamino)butanoyloxy]nonadecanoate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCCC(CCCCCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C34H65NO4/c1-5-7-9-11-13-17-21-26-32(39-34(37)29-25-30-35(3)4)27-22-18-14-15-19-23-28-33(36)38-31-24-20-16-12-10-8-6-2/h20,24,32H,5-19,21-23,25-31H2,1-4H3/b24-20- |
| InChIKey | MZATYKUQTVHHOT-GFMRDNFCSA-N |
| XLogP | 9.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.90 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|