C40H73NO6 — CID 58070074
1-O-[(Z)-dodec-3-enyl] 11-O-[(Z)-undec-2-enyl] 6-[4-(dimethylamino)butanoyloxy]undecanedioate (PubChem CID 58070074) has the molecular formula C40H73NO6 and a molecular weight of 664.03 g/mol. Its IUPAC name is 1-O-[(Z)-dodec-3-enyl] 11-O-[(Z)-undec-2-enyl] 6-[4-(dimethylamino)butanoyloxy]undecanedioate.
| Compound Name | 1-O-[(Z)-dodec-3-enyl] 11-O-[(Z)-undec-2-enyl] 6-[4-(dimethylamino)butanoyloxy]undecanedioate |
|---|---|
| PubChem CID | 58070074 |
| Molecular Formula | C40H73NO6 |
| Molecular Weight | 664.03 g/mol |
| Exact Mass | 663.54 |
| IUPAC Name | 1-O-[(Z)-dodec-3-enyl] 11-O-[(Z)-undec-2-enyl] 6-[4-(dimethylamino)butanoyloxy]undecanedioate |
| SMILES | CCCCCCCC/C=C\CCOC(=O)CCCCC(CCCCC(=O)OC/C=C\CCCCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C40H73NO6/c1-5-7-9-11-13-15-17-19-21-27-36-46-39(43)32-25-23-30-37(47-40(44)33-28-34-41(3)4)29-22-24-31-38(42)45-35-26-20-18-16-14-12-10-8-6-2/h19-21,26,37H,5-18,22-25,27-36H2,1-4H3/b21-19-,26-20- |
| InChIKey | HSHCPZZBLYLRKI-WEHWYFFISA-N |
| XLogP | 10.45 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.03 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|