C63H120N2O8 — CID 176847326
ditridecan-7-yl 10-[3-(dimethylamino)propyl-[4-[(Z)-oct-3-enoxy]-4-oxobutyl]carbamoyl]oxynonadecanedioate (PubChem CID 176847326) has the molecular formula C63H120N2O8 and a molecular weight of 1033.66 g/mol. Its IUPAC name is ditridecan-7-yl 10-[3-(dimethylamino)propyl-[4-[(Z)-oct-3-enoxy]-4-oxobutyl]carbamoyl]oxynonadecanedioate.
| Compound Name | ditridecan-7-yl 10-[3-(dimethylamino)propyl-[4-[(Z)-oct-3-enoxy]-4-oxobutyl]carbamoyl]oxynonadecanedioate |
|---|---|
| PubChem CID | 176847326 |
| Molecular Formula | C63H120N2O8 |
| Molecular Weight | 1033.66 g/mol |
| Exact Mass | 1032.90 |
| IUPAC Name | ditridecan-7-yl 10-[3-(dimethylamino)propyl-[4-[(Z)-oct-3-enoxy]-4-oxobutyl]carbamoyl]oxynonadecanedioate |
| SMILES | CCCC/C=C\CCOC(=O)CCCN(CCCN(C)C)C(=O)OC(CCCCCCCCC(=O)OC(CCCCCC)CCCCCC)CCCCCCCCC(=O)OC(CCCCCC)CCCCCC |
| InChI | InChI=1S/C63H120N2O8/c1-8-13-18-23-32-41-56-70-60(66)52-42-54-65(55-43-53-64(6)7)63(69)73-59(48-37-28-24-26-30-39-50-61(67)71-57(44-33-19-14-9-2)45-34-20-15-10-3)49-38-29-25-27-31-40-51-62(68)72-58(46-35-21-16-11-4)47-36-22-17-12-5/h23,32,57-59H,8-22,24-31,33-56H2,1-7H3/b32-23- |
| InChIKey | SMIKFIUHAJDILM-SJIPCVTESA-N |
| XLogP | 18.15 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 55 |
| Heavy Atoms | 73 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1033.66 |
| LogP ≤ 5 | 18.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|