C35H67NO4 — CID 71815122
methyl (Z)-19-[4-(dimethylamino)butanoyloxy]octacos-7-enoate (PubChem CID 71815122) has the molecular formula C35H67NO4 and a molecular weight of 565.92 g/mol. Its IUPAC name is methyl (Z)-19-[4-(dimethylamino)butanoyloxy]octacos-7-enoate.
| Compound Name | methyl (Z)-19-[4-(dimethylamino)butanoyloxy]octacos-7-enoate |
|---|---|
| PubChem CID | 71815122 |
| Molecular Formula | C35H67NO4 |
| Molecular Weight | 565.92 g/mol |
| Exact Mass | 565.51 |
| IUPAC Name | methyl (Z)-19-[4-(dimethylamino)butanoyloxy]octacos-7-enoate |
| SMILES | CCCCCCCCCC(CCCCCCCCCC/C=C\CCCCCC(=O)OC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C35H67NO4/c1-5-6-7-8-18-21-24-28-33(40-35(38)31-27-32-36(2)3)29-25-22-19-16-14-12-10-9-11-13-15-17-20-23-26-30-34(37)39-4/h13,15,33H,5-12,14,16-32H2,1-4H3/b15-13- |
| InChIKey | AIGOGXRDORBQLA-SQFISAMPSA-N |
| XLogP | 9.96 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.92 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|