C33H63NO4 — CID 90009054
(Z)-21-[4-(dimethylamino)butanoyloxy]heptacos-9-enoic acid (PubChem CID 90009054) has the molecular formula C33H63NO4 and a molecular weight of 537.87 g/mol. Its IUPAC name is (Z)-21-[4-(dimethylamino)butanoyloxy]heptacos-9-enoic acid.
| Compound Name | (Z)-21-[4-(dimethylamino)butanoyloxy]heptacos-9-enoic acid |
|---|---|
| PubChem CID | 90009054 |
| Molecular Formula | C33H63NO4 |
| Molecular Weight | 537.87 g/mol |
| Exact Mass | 537.48 |
| IUPAC Name | (Z)-21-[4-(dimethylamino)butanoyloxy]heptacos-9-enoic acid |
| SMILES | CCCCCCC(CCCCCCCCCC/C=C\CCCCCCCC(=O)O)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C33H63NO4/c1-4-5-6-22-26-31(38-33(37)29-25-30-34(2)3)27-23-20-18-16-14-12-10-8-7-9-11-13-15-17-19-21-24-28-32(35)36/h9,11,31H,4-8,10,12-30H2,1-3H3,(H,35,36)/b11-9- |
| InChIKey | NGFMKRAYPCAUKW-LUAWRHEFSA-N |
| XLogP | 9.48 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.87 |
| LogP ≤ 5 | 9.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|