C36H69NO4 — CID 90008950
(Z)-21-[4-(dimethylamino)butanoyloxy]triacont-9-enoic acid (PubChem CID 90008950) has the molecular formula C36H69NO4 and a molecular weight of 579.95 g/mol. Its IUPAC name is (Z)-21-[4-(dimethylamino)butanoyloxy]triacont-9-enoic acid.
| Compound Name | (Z)-21-[4-(dimethylamino)butanoyloxy]triacont-9-enoic acid |
|---|---|
| PubChem CID | 90008950 |
| Molecular Formula | C36H69NO4 |
| Molecular Weight | 579.95 g/mol |
| Exact Mass | 579.52 |
| IUPAC Name | (Z)-21-[4-(dimethylamino)butanoyloxy]triacont-9-enoic acid |
| SMILES | CCCCCCCCCC(CCCCCCCCCC/C=C\CCCCCCCC(=O)O)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C36H69NO4/c1-4-5-6-7-19-22-25-29-34(41-36(40)32-28-33-37(2)3)30-26-23-20-17-15-13-11-9-8-10-12-14-16-18-21-24-27-31-35(38)39/h10,12,34H,4-9,11,13-33H2,1-3H3,(H,38,39)/b12-10- |
| InChIKey | BZDVTLUSULDTKK-BENRWUELSA-N |
| XLogP | 10.65 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.95 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|