C34H63NO4 — CID 118061575
(19Z,22Z)-9-[4-(dimethylamino)butanoyloxy]octacosa-19,22-dienoic acid (PubChem CID 118061575) has the molecular formula C34H63NO4 and a molecular weight of 549.88 g/mol. Its IUPAC name is (19Z,22Z)-9-[4-(dimethylamino)butanoyloxy]octacosa-19,22-dienoic acid.
| Compound Name | (19Z,22Z)-9-[4-(dimethylamino)butanoyloxy]octacosa-19,22-dienoic acid |
|---|---|
| PubChem CID | 118061575 |
| Molecular Formula | C34H63NO4 |
| Molecular Weight | 549.88 g/mol |
| Exact Mass | 549.48 |
| IUPAC Name | (19Z,22Z)-9-[4-(dimethylamino)butanoyloxy]octacosa-19,22-dienoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(CCCCCCCC(=O)O)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C34H63NO4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20-23-27-32(39-34(38)30-26-31-35(2)3)28-24-21-19-22-25-29-33(36)37/h8-9,11-12,32H,4-7,10,13-31H2,1-3H3,(H,36,37)/b9-8-,12-11- |
| InChIKey | RQMXCAVAXGLFRI-MURFETPASA-N |
| XLogP | 9.65 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.88 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|