C34H62O4 — CID 134724532
8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid (PubChem CID 134724532) has the molecular formula C34H62O4 and a molecular weight of 534.87 g/mol. Its IUPAC name is 8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid.
| Compound Name | 8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid |
|---|---|
| PubChem CID | 134724532 |
| Molecular Formula | C34H62O4 |
| Molecular Weight | 534.87 g/mol |
| Exact Mass | 534.46 |
| IUPAC Name | 8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(CCCCCC)CCCCCCC(=O)O |
| InChI | InChI=1S/C34H62O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-27-31-34(37)38-32(28-24-8-6-4-2)29-25-22-23-26-30-33(35)36/h10-11,13-14,32H,3-9,12,15-31H2,1-2H3,(H,35,36)/b11-10-,14-13- |
| InChIKey | CNQPBZNHCZKOOI-XVTLYKPTSA-N |
| XLogP | 10.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.87 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|