8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid

C34H62O4 — CID 134724532

IUPAC8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid
SMILESCCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(CCCCCC)CCCCCCC(=O)O
InChIInChI=1S/C34H62O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-27-31-34(37)38-32(28-24-8-6-4-2)29-25-22-23-26-30-33(35)36/h10-11,13-14,32H,3-9,12,15-31H2,1-2H3,(H,35,36)/b11-10-,14-13-
InChIKeyCNQPBZNHCZKOOI-XVTLYKPTSA-N
MW534.87 g/mol
LogP10.89
Rot. Bonds29

About 8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid

8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid (PubChem CID 134724532) has the molecular formula C34H62O4 and a molecular weight of 534.87 g/mol. Its IUPAC name is 8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid.

Molecular Properties

Compound Name8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid
PubChem CID134724532
Molecular FormulaC34H62O4
Molecular Weight534.87 g/mol
Exact Mass534.46
IUPAC Name8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid
SMILESCCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(CCCCCC)CCCCCCC(=O)O
InChIInChI=1S/C34H62O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-27-31-34(37)38-32(28-24-8-6-4-2)29-25-22-23-26-30-33(35)36/h10-11,13-14,32H,3-9,12,15-31H2,1-2H3,(H,35,36)/b11-10-,14-13-
InChIKeyCNQPBZNHCZKOOI-XVTLYKPTSA-N
XLogP10.89
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds29
Heavy Atoms38
Complexity—

Lipinski Rule of Five

2 violations

RuleValue
MW ≤ 500534.87
LogP ≤ 510.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid?
The IUPAC name of 8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid (CID 134724532) is 8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid.
What is the SMILES notation for 8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid?
The canonical SMILES for 8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid is CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(CCCCCC)CCCCCCC(=O)O.
What is the InChIKey of 8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid?
The InChIKey is CNQPBZNHCZKOOI-XVTLYKPTSA-N. The full InChI is InChI=1S/C34H62O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-27-31-34(37)38-32(28-24-8-6-4-2)29-25-22-23-26-30-33(35)36/h10-11,13-14,32H,3-9,12,15-31H2,1-2H3,(H,35,36)/b11-10-,14-13-.
What are the key properties of 8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid?
8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid has a molecular weight of 534.87 g/mol, XLogP of 10.89, 29 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(11Z,14Z)-icosa-11,14-dienoyl]oxytetradecanoic acid is sourced from PubChem (CID 134724532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).