C35H64O4 — CID 138238916
8-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyhexadecanoic acid (PubChem CID 138238916) has the molecular formula C35H64O4 and a molecular weight of 548.89 g/mol. Its IUPAC name is 8-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyhexadecanoic acid.
| Compound Name | 8-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyhexadecanoic acid |
|---|---|
| PubChem CID | 138238916 |
| Molecular Formula | C35H64O4 |
| Molecular Weight | 548.89 g/mol |
| Exact Mass | 548.48 |
| IUPAC Name | 8-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxyhexadecanoic acid |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCC(=O)O |
| InChI | InChI=1S/C35H64O4/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-28-32-35(38)39-33(29-25-21-10-8-6-4-2)30-26-23-24-27-31-34(36)37/h12-13,15-16,33H,3-11,14,17-32H2,1-2H3,(H,36,37)/b13-12-,16-15- |
| InChIKey | PSBCJDDMEKZDKR-QGLGPCELSA-N |
| XLogP | 11.28 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.89 |
| LogP ≤ 5 | 11.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|