C37H64O4 — CID 134736256
8-[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]oxypentadecanoic acid (PubChem CID 134736256) has the molecular formula C37H64O4 and a molecular weight of 572.92 g/mol. Its IUPAC name is 8-[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]oxypentadecanoic acid.
| Compound Name | 8-[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]oxypentadecanoic acid |
|---|---|
| PubChem CID | 134736256 |
| Molecular Formula | C37H64O4 |
| Molecular Weight | 572.92 g/mol |
| Exact Mass | 572.48 |
| IUPAC Name | 8-[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]oxypentadecanoic acid |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCC(=O)OC(CCCCCCC)CCCCCCC(=O)O |
| InChI | InChI=1S/C37H64O4/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24-30-34-37(40)41-35(31-27-23-8-6-4-2)32-28-25-26-29-33-36(38)39/h10-11,13-14,16-17,19-20,35H,3-9,12,15,18,21-34H2,1-2H3,(H,38,39)/b11-10-,14-13-,17-16-,20-19- |
| InChIKey | HRAISSIMHKHRJX-AILJCPQKSA-N |
| XLogP | 11.61 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.92 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|