C37H67NO6 — CID 58069916
bis[(Z)-oct-2-enyl] 8-[4-(dimethylamino)butanoyloxy]pentadecanedioate (PubChem CID 58069916) has the molecular formula C37H67NO6 and a molecular weight of 621.94 g/mol. Its IUPAC name is bis[(Z)-oct-2-enyl] 8-[4-(dimethylamino)butanoyloxy]pentadecanedioate.
| Compound Name | bis[(Z)-oct-2-enyl] 8-[4-(dimethylamino)butanoyloxy]pentadecanedioate |
|---|---|
| PubChem CID | 58069916 |
| Molecular Formula | C37H67NO6 |
| Molecular Weight | 621.94 g/mol |
| Exact Mass | 621.50 |
| IUPAC Name | bis[(Z)-oct-2-enyl] 8-[4-(dimethylamino)butanoyloxy]pentadecanedioate |
| SMILES | CCCCC/C=C\COC(=O)CCCCCCC(CCCCCCC(=O)OC/C=C\CCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C37H67NO6/c1-5-7-9-11-17-23-32-42-35(39)28-21-15-13-19-26-34(44-37(41)30-25-31-38(3)4)27-20-14-16-22-29-36(40)43-33-24-18-12-10-8-6-2/h17-18,23-24,34H,5-16,19-22,25-33H2,1-4H3/b23-17-,24-18- |
| InChIKey | CEPBOUGWJBJFKS-BOYKQRMESA-N |
| XLogP | 9.28 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.94 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|