C41H77NO5 — CID 123545182
non-2-enyl 9-[4-(dimethylamino)butanoyloxy]-17-non-2-enoxyheptadecanoate (PubChem CID 123545182) has the molecular formula C41H77NO5 and a molecular weight of 664.07 g/mol. Its IUPAC name is non-2-enyl 9-[4-(dimethylamino)butanoyloxy]-17-non-2-enoxyheptadecanoate.
| Compound Name | non-2-enyl 9-[4-(dimethylamino)butanoyloxy]-17-non-2-enoxyheptadecanoate |
|---|---|
| PubChem CID | 123545182 |
| Molecular Formula | C41H77NO5 |
| Molecular Weight | 664.07 g/mol |
| Exact Mass | 663.58 |
| IUPAC Name | non-2-enyl 9-[4-(dimethylamino)butanoyloxy]-17-non-2-enoxyheptadecanoate |
| SMILES | CCCCCCC=CCOCCCCCCCCC(CCCCCCCC(=O)OCC=CCCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C41H77NO5/c1-5-7-9-11-14-21-27-36-45-37-28-22-16-13-18-24-31-39(47-41(44)34-30-35-42(3)4)32-25-19-17-20-26-33-40(43)46-38-29-23-15-12-10-8-6-2/h21,23,27,29,39H,5-20,22,24-26,28,30-38H2,1-4H3 |
| InChIKey | IFYBGHYHNLZUOO-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.07 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|