C31H58O4 — CID 157416257
1-O-[(Z)-non-2-enyl] 9-O-tridecan-7-yl nonanedioate (PubChem CID 157416257) has the molecular formula C31H58O4 and a molecular weight of 494.80 g/mol. Its IUPAC name is 1-O-[(Z)-non-2-enyl] 9-O-tridecan-7-yl nonanedioate.
| Compound Name | 1-O-[(Z)-non-2-enyl] 9-O-tridecan-7-yl nonanedioate |
|---|---|
| PubChem CID | 157416257 |
| Molecular Formula | C31H58O4 |
| Molecular Weight | 494.80 g/mol |
| Exact Mass | 494.43 |
| IUPAC Name | 1-O-[(Z)-non-2-enyl] 9-O-tridecan-7-yl nonanedioate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCC(=O)OC(CCCCCC)CCCCCC |
| InChI | InChI=1S/C31H58O4/c1-4-7-10-13-14-18-23-28-34-30(32)26-21-16-15-17-22-27-31(33)35-29(24-19-11-8-5-2)25-20-12-9-6-3/h18,23,29H,4-17,19-22,24-28H2,1-3H3/b23-18- |
| InChIKey | FZNPQDDJLCSXKY-NKFKGCMQSA-N |
| XLogP | 9.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.80 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|