C75H140O8 — CID 101104447
[1-[5-[9-[(Z)-octadec-9-enoyl]oxyheptadecanoyloxy]pentoxy]-1-oxoheptadecan-9-yl] (Z)-octadec-9-enoate (PubChem CID 101104447) has the molecular formula C75H140O8 and a molecular weight of 1169.94 g/mol. Its IUPAC name is [1-[5-[9-[(Z)-octadec-9-enoyl]oxyheptadecanoyloxy]pentoxy]-1-oxoheptadecan-9-yl] (Z)-octadec-9-enoate.
| Compound Name | [1-[5-[9-[(Z)-octadec-9-enoyl]oxyheptadecanoyloxy]pentoxy]-1-oxoheptadecan-9-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 101104447 |
| Molecular Formula | C75H140O8 |
| Molecular Weight | 1169.94 g/mol |
| Exact Mass | 1169.05 |
| IUPAC Name | [1-[5-[9-[(Z)-octadec-9-enoyl]oxyheptadecanoyloxy]pentoxy]-1-oxoheptadecan-9-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC(=O)OCCCCCOC(=O)CCCCCCCC(CCCCCCCC)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C75H140O8/c1-5-9-13-17-21-23-25-27-29-31-33-35-37-45-56-66-74(78)82-70(60-50-41-19-15-11-7-3)62-52-43-39-47-54-64-72(76)80-68-58-49-59-69-81-73(77)65-55-48-40-44-53-63-71(61-51-42-20-16-12-8-4)83-75(79)67-57-46-38-36-34-32-30-28-26-24-22-18-14-10-6-2/h27-30,70-71H,5-26,31-69H2,1-4H3/b29-27-,30-28- |
| InChIKey | KGGIXAQLAMPSOK-ZUELCTOOSA-N |
| XLogP | 24.10 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 68 |
| Heavy Atoms | 83 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1169.94 |
| LogP ≤ 5 | 24.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|