C70H130O12 — CID 166582221
10-[10,13-di(hexanoyloxy)octadecanoyloxy]decyl 9,12-di(hexanoyloxy)octadecanoate (PubChem CID 166582221) has the molecular formula C70H130O12 and a molecular weight of 1163.80 g/mol. Its IUPAC name is 10-[10,13-di(hexanoyloxy)octadecanoyloxy]decyl 9,12-di(hexanoyloxy)octadecanoate.
| Compound Name | 10-[10,13-di(hexanoyloxy)octadecanoyloxy]decyl 9,12-di(hexanoyloxy)octadecanoate |
|---|---|
| PubChem CID | 166582221 |
| Molecular Formula | C70H130O12 |
| Molecular Weight | 1163.80 g/mol |
| Exact Mass | 1162.96 |
| IUPAC Name | 10-[10,13-di(hexanoyloxy)octadecanoyloxy]decyl 9,12-di(hexanoyloxy)octadecanoate |
| SMILES | CCCCCCC(CCC(CCCCCCCC(=O)OCCCCCCCCCCOC(=O)CCCCCCCCC(CCC(CCCCC)OC(=O)CCCCC)OC(=O)CCCCC)OC(=O)CCCCC)OC(=O)CCCCC |
| InChI | InChI=1S/C70H130O12/c1-7-13-19-38-46-62(80-68(74)52-35-16-10-4)57-58-64(82-70(76)54-37-18-12-6)48-40-28-26-30-42-50-66(72)78-60-44-32-25-21-20-24-31-43-59-77-65(71)49-41-29-23-22-27-39-47-63(81-69(75)53-36-17-11-5)56-55-61(45-33-14-8-2)79-67(73)51-34-15-9-3/h61-64H,7-60H2,1-6H3 |
| InChIKey | PMIIYBQEXZYHGT-UHFFFAOYSA-N |
| XLogP | 20.12 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 63 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1163.80 |
| LogP ≤ 5 | 20.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|