About 9-(10-acetyloxyoctadecanoyloxy)nonyl 9-acetyloxyoctadecanoate
9-(10-acetyloxyoctadecanoyloxy)nonyl 9-acetyloxyoctadecanoate (PubChem CID 166582077) has the molecular formula C49H92O8
and a molecular weight of 809.27 g/mol. Its IUPAC name is 9-(10-acetyloxyoctadecanoyloxy)nonyl 9-acetyloxyoctadecanoate.
Molecular Properties
| Compound Name | 9-(10-acetyloxyoctadecanoyloxy)nonyl 9-acetyloxyoctadecanoate |
| PubChem CID | 166582077 |
| Molecular Formula | C49H92O8 |
| Molecular Weight | 809.27 g/mol |
| Exact Mass | 808.68 |
| IUPAC Name | 9-(10-acetyloxyoctadecanoyloxy)nonyl 9-acetyloxyoctadecanoate |
| SMILES | CCCCCCCCCC(CCCCCCCC(=O)OCCCCCCCCCOC(=O)CCCCCCCCC(CCCCCCCC)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C49H92O8/c1-5-7-9-11-14-21-29-37-47(57-45(4)51)39-31-23-19-25-33-41-49(53)55-43-35-27-18-13-17-26-34-42-54-48(52)40-32-24-16-15-22-30-38-46(56-44(3)50)36-28-20-12-10-8-6-2/h46-47H,5-43H2,1-4H3 |
| InChIKey | JTRQILLVEYAVFY-UHFFFAOYSA-N |
| XLogP | 14.41 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 57 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 809.27 |
| LogP ≤ 5 | 14.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9-(10-acetyloxyoctadecanoyloxy)nonyl 9-acetyloxyoctadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(10-acetyloxyoctadecanoyloxy)nonyl 9-acetyloxyoctadecanoate?
The IUPAC name of 9-(10-acetyloxyoctadecanoyloxy)nonyl 9-acetyloxyoctadecanoate (CID 166582077) is 9-(10-acetyloxyoctadecanoyloxy)nonyl 9-acetyloxyoctadecanoate.
What is the SMILES notation for 9-(10-acetyloxyoctadecanoyloxy)nonyl 9-acetyloxyoctadecanoate?
The canonical SMILES for 9-(10-acetyloxyoctadecanoyloxy)nonyl 9-acetyloxyoctadecanoate is CCCCCCCCCC(CCCCCCCC(=O)OCCCCCCCCCOC(=O)CCCCCCCCC(CCCCCCCC)OC(C)=O)OC(C)=O.
What is the InChIKey of 9-(10-acetyloxyoctadecanoyloxy)nonyl 9-acetyloxyoctadecanoate?
The InChIKey is JTRQILLVEYAVFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C49H92O8/c1-5-7-9-11-14-21-29-37-47(57-45(4)51)39-31-23-19-25-33-41-49(53)55-43-35-27-18-13-17-26-34-42-54-48(52)40-32-24-16-15-22-30-38-46(56-44(3)50)36-28-20-12-10-8-6-2/h46-47H,5-43H2,1-4H3.
What are the key properties of 9-(10-acetyloxyoctadecanoyloxy)nonyl 9-acetyloxyoctadecanoate?
9-(10-acetyloxyoctadecanoyloxy)nonyl 9-acetyloxyoctadecanoate has a molecular weight of 809.27 g/mol, XLogP of 14.41, 44 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(10-acetyloxyoctadecanoyloxy)nonyl 9-acetyloxyoctadecanoate is sourced from PubChem (CID 166582077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).