C81H152O12 — CID 156621563
2-[2-[2-[2-[9-[(E)-octadec-9-enoyl]oxyoctadecanoyloxy]ethoxy]ethoxymethoxy]ethoxy]ethyl 9-[(E)-octadec-9-enoyl]oxyoctadecanoate (PubChem CID 156621563) has the molecular formula C81H152O12 and a molecular weight of 1318.09 g/mol. Its IUPAC name is 2-[2-[2-[2-[9-[(E)-octadec-9-enoyl]oxyoctadecanoyloxy]ethoxy]ethoxymethoxy]ethoxy]ethyl 9-[(E)-octadec-9-enoyl]oxyoctadecanoate.
| Compound Name | 2-[2-[2-[2-[9-[(E)-octadec-9-enoyl]oxyoctadecanoyloxy]ethoxy]ethoxymethoxy]ethoxy]ethyl 9-[(E)-octadec-9-enoyl]oxyoctadecanoate |
|---|---|
| PubChem CID | 156621563 |
| Molecular Formula | C81H152O12 |
| Molecular Weight | 1318.09 g/mol |
| Exact Mass | 1317.13 |
| IUPAC Name | 2-[2-[2-[2-[9-[(E)-octadec-9-enoyl]oxyoctadecanoyloxy]ethoxy]ethoxymethoxy]ethoxy]ethyl 9-[(E)-octadec-9-enoyl]oxyoctadecanoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OC(CCCCCCCCC)CCCCCCCC(=O)OCCOCCOCOCCOCCOC(=O)CCCCCCCC(CCCCCCCCC)OC(=O)CCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C81H152O12/c1-5-9-13-17-21-23-25-27-29-31-33-35-39-47-57-65-80(84)92-76(59-51-43-37-19-15-11-7-3)61-53-45-41-49-55-63-78(82)90-73-71-86-67-69-88-75-89-70-68-87-72-74-91-79(83)64-56-50-42-46-54-62-77(60-52-44-38-20-16-12-8-4)93-81(85)66-58-48-40-36-34-32-30-28-26-24-22-18-14-10-6-2/h27-30,76-77H,5-26,31-75H2,1-4H3/b29-27+,30-28+ |
| InChIKey | PSSQACWIRWWOQP-QAVVBOBSSA-N |
| XLogP | 23.74 |
| TPSA | 142.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 78 |
| Heavy Atoms | 93 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1318.09 |
| LogP ≤ 5 | 23.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|