C39H69BrO6 — CID 123979530
bis(non-2-enyl) 9-(4-bromobutanoyloxy)heptadecanedioate (PubChem CID 123979530) has the molecular formula C39H69BrO6 and a molecular weight of 713.88 g/mol. Its IUPAC name is bis(non-2-enyl) 9-(4-bromobutanoyloxy)heptadecanedioate.
| Compound Name | bis(non-2-enyl) 9-(4-bromobutanoyloxy)heptadecanedioate |
|---|---|
| PubChem CID | 123979530 |
| Molecular Formula | C39H69BrO6 |
| Molecular Weight | 713.88 g/mol |
| Exact Mass | 712.43 |
| IUPAC Name | bis(non-2-enyl) 9-(4-bromobutanoyloxy)heptadecanedioate |
| SMILES | CCCCCCC=CCOC(=O)CCCCCCCC(CCCCCCCC(=O)OCC=CCCCCCC)OC(=O)CCCBr |
| InChI | InChI=1S/C39H69BrO6/c1-3-5-7-9-11-19-25-34-44-37(41)30-23-17-13-15-21-28-36(46-39(43)32-27-33-40)29-22-16-14-18-24-31-38(42)45-35-26-20-12-10-8-6-4-2/h19-20,25-26,36H,3-18,21-24,27-35H2,1-2H3 |
| InChIKey | UQSAYVHQFNJLAL-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.88 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|