C54H105NO6 — CID 158592077
hexadecan-8-yl 4-aminobutanoate;9-O-hexadecan-8-yl 1-O-[(Z)-non-2-enyl] nonanedioate (PubChem CID 158592077) has the molecular formula C54H105NO6 and a molecular weight of 864.43 g/mol. Its IUPAC name is hexadecan-8-yl 4-aminobutanoate;9-O-hexadecan-8-yl 1-O-[(Z)-non-2-enyl] nonanedioate.
| Compound Name | hexadecan-8-yl 4-aminobutanoate;9-O-hexadecan-8-yl 1-O-[(Z)-non-2-enyl] nonanedioate |
|---|---|
| PubChem CID | 158592077 |
| Molecular Formula | C54H105NO6 |
| Molecular Weight | 864.43 g/mol |
| Exact Mass | 863.79 |
| IUPAC Name | hexadecan-8-yl 4-aminobutanoate;9-O-hexadecan-8-yl 1-O-[(Z)-non-2-enyl] nonanedioate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCC(=O)OC(CCCCCCC)CCCCCCCC.CCCCCCCCC(CCCCCCC)OC(=O)CCCN |
| InChI | InChI=1S/C34H64O4.C20H41NO2/c1-4-7-10-13-15-21-26-31-37-33(35)29-24-19-16-20-25-30-34(36)38-32(27-22-17-12-9-6-3)28-23-18-14-11-8-5-2;1-3-5-7-9-11-13-16-19(15-12-10-8-6-4-2)23-20(22)17-14-18-21/h21,26,32H,4-20,22-25,27-31H2,1-3H3;19H,3-18,21H2,1-2H3/b26-21-; |
| InChIKey | HUOMOLIJCMZYGD-AURQPEIRSA-N |
| XLogP | 16.56 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.43 |
| LogP ≤ 5 | 16.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|