About bis[(Z)-non-2-enyl] 10-acetyloxynonadecanedioate
bis[(Z)-non-2-enyl] 10-acetyloxynonadecanedioate (PubChem CID 171792484) has the molecular formula C39H70O6
and a molecular weight of 634.98 g/mol. Its IUPAC name is bis[(Z)-non-2-enyl] 10-acetyloxynonadecanedioate.
Molecular Properties
| Compound Name | bis[(Z)-non-2-enyl] 10-acetyloxynonadecanedioate |
| PubChem CID | 171792484 |
| Molecular Formula | C39H70O6 |
| Molecular Weight | 634.98 g/mol |
| Exact Mass | 634.52 |
| IUPAC Name | bis[(Z)-non-2-enyl] 10-acetyloxynonadecanedioate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCCC(CCCCCCCCC(=O)OC/C=C\CCCCCC)OC(C)=O |
| InChI | InChI=1S/C39H70O6/c1-4-6-8-10-16-22-28-34-43-38(41)32-26-20-14-12-18-24-30-37(45-36(3)40)31-25-19-13-15-21-27-33-39(42)44-35-29-23-17-11-9-7-5-2/h22-23,28-29,37H,4-21,24-27,30-35H2,1-3H3/b28-22-,29-23- |
| InChIKey | PNTFSOZUFIXZOL-UNVYMFJTSA-N |
| XLogP | 11.30 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 634.98 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze bis[(Z)-non-2-enyl] 10-acetyloxynonadecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(Z)-non-2-enyl] 10-acetyloxynonadecanedioate?
The IUPAC name of bis[(Z)-non-2-enyl] 10-acetyloxynonadecanedioate (CID 171792484) is bis[(Z)-non-2-enyl] 10-acetyloxynonadecanedioate.
What is the SMILES notation for bis[(Z)-non-2-enyl] 10-acetyloxynonadecanedioate?
The canonical SMILES for bis[(Z)-non-2-enyl] 10-acetyloxynonadecanedioate is CCCCCC/C=C\COC(=O)CCCCCCCCC(CCCCCCCCC(=O)OC/C=C\CCCCCC)OC(C)=O.
What is the InChIKey of bis[(Z)-non-2-enyl] 10-acetyloxynonadecanedioate?
The InChIKey is PNTFSOZUFIXZOL-UNVYMFJTSA-N. The full InChI is InChI=1S/C39H70O6/c1-4-6-8-10-16-22-28-34-43-38(41)32-26-20-14-12-18-24-30-37(45-36(3)40)31-25-19-13-15-21-27-33-39(42)44-35-29-23-17-11-9-7-5-2/h22-23,28-29,37H,4-21,24-27,30-35H2,1-3H3/b28-22-,29-23-.
What are the key properties of bis[(Z)-non-2-enyl] 10-acetyloxynonadecanedioate?
bis[(Z)-non-2-enyl] 10-acetyloxynonadecanedioate has a molecular weight of 634.98 g/mol, XLogP of 11.30, 33 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(Z)-non-2-enyl] 10-acetyloxynonadecanedioate is sourced from PubChem (CID 171792484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).