C51H93NO8 — CID 175901869
1-O-[2-[4-(dimethylamino)butanoyloxy]-3-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 7-O-heptadecan-9-yl heptanedioate (PubChem CID 175901869) has the molecular formula C51H93NO8 and a molecular weight of 848.30 g/mol. Its IUPAC name is 1-O-[2-[4-(dimethylamino)butanoyloxy]-3-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 7-O-heptadecan-9-yl heptanedioate.
| Compound Name | 1-O-[2-[4-(dimethylamino)butanoyloxy]-3-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 7-O-heptadecan-9-yl heptanedioate |
|---|---|
| PubChem CID | 175901869 |
| Molecular Formula | C51H93NO8 |
| Molecular Weight | 848.30 g/mol |
| Exact Mass | 847.69 |
| IUPAC Name | 1-O-[2-[4-(dimethylamino)butanoyloxy]-3-[(9E,12E)-octadeca-9,12-dienoyl]oxypropyl] 7-O-heptadecan-9-yl heptanedioate |
| SMILES | CCCCC/C=C/C/C=C/CCCCCCCC(=O)OCC(COC(=O)CCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C51H93NO8/c1-6-9-12-15-18-19-20-21-22-23-24-25-26-29-33-39-48(53)57-44-47(60-51(56)42-36-43-52(4)5)45-58-49(54)40-34-30-35-41-50(55)59-46(37-31-27-16-13-10-7-2)38-32-28-17-14-11-8-3/h18-19,21-22,46-47H,6-17,20,23-45H2,1-5H3/b19-18+,22-21+ |
| InChIKey | FGRXEBRORXPKDG-ABWZDJEGSA-N |
| XLogP | 13.50 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 848.30 |
| LogP ≤ 5 | 13.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|