C46H87NO4 — CID 118168896
[(12Z,15Z)-3-[4-(dimethylamino)butanoyloxy]henicosa-12,15-dienyl] 7-hexyltridecanoate (PubChem CID 118168896) has the molecular formula C46H87NO4 and a molecular weight of 718.20 g/mol. Its IUPAC name is [(12Z,15Z)-3-[4-(dimethylamino)butanoyloxy]henicosa-12,15-dienyl] 7-hexyltridecanoate.
| Compound Name | [(12Z,15Z)-3-[4-(dimethylamino)butanoyloxy]henicosa-12,15-dienyl] 7-hexyltridecanoate |
|---|---|
| PubChem CID | 118168896 |
| Molecular Formula | C46H87NO4 |
| Molecular Weight | 718.20 g/mol |
| Exact Mass | 717.66 |
| IUPAC Name | [(12Z,15Z)-3-[4-(dimethylamino)butanoyloxy]henicosa-12,15-dienyl] 7-hexyltridecanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCOC(=O)CCCCCC(CCCCCC)CCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C46H87NO4/c1-6-9-12-15-16-17-18-19-20-21-22-23-24-25-26-31-37-44(51-46(49)39-33-41-47(4)5)40-42-50-45(48)38-32-27-30-36-43(34-28-13-10-7-2)35-29-14-11-8-3/h16-17,19-20,43-44H,6-15,18,21-42H2,1-5H3/b17-16-,20-19- |
| InChIKey | AYSFJYKSIYDMIH-LTXDKZCQSA-N |
| XLogP | 13.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.20 |
| LogP ≤ 5 | 13.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|