C47H91NO2 — CID 151312855
3-pentyloctyl (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienoate (PubChem CID 151312855) has the molecular formula C47H91NO2 and a molecular weight of 702.25 g/mol. Its IUPAC name is 3-pentyloctyl (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienoate.
| Compound Name | 3-pentyloctyl (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienoate |
|---|---|
| PubChem CID | 151312855 |
| Molecular Formula | C47H91NO2 |
| Molecular Weight | 702.25 g/mol |
| Exact Mass | 701.70 |
| IUPAC Name | 3-pentyloctyl (20Z,23Z)-10-[3-(dimethylamino)propyl]nonacosa-20,23-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(CCCCCCCCC(=O)OCCC(CCCCC)CCCCC)CCCN(C)C |
| InChI | InChI=1S/C47H91NO2/c1-6-9-12-13-14-15-16-17-18-19-20-21-22-23-24-27-32-38-45(40-35-43-48(4)5)39-33-28-25-26-29-34-41-47(49)50-44-42-46(36-30-10-7-2)37-31-11-8-3/h14-15,17-18,45-46H,6-13,16,19-44H2,1-5H3/b15-14-,18-17- |
| InChIKey | OEUGYSJRGRLLHC-NFYLBXPESA-N |
| XLogP | 15.37 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.25 |
| LogP ≤ 5 | 15.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|