C32H63NO2 — CID 167102584
[(Z)-tridec-2-enyl] 6-[2-(dimethylamino)ethyl]pentadecanoate (PubChem CID 167102584) has the molecular formula C32H63NO2 and a molecular weight of 493.86 g/mol. Its IUPAC name is [(Z)-tridec-2-enyl] 6-[2-(dimethylamino)ethyl]pentadecanoate.
| Compound Name | [(Z)-tridec-2-enyl] 6-[2-(dimethylamino)ethyl]pentadecanoate |
|---|---|
| PubChem CID | 167102584 |
| Molecular Formula | C32H63NO2 |
| Molecular Weight | 493.86 g/mol |
| Exact Mass | 493.49 |
| IUPAC Name | [(Z)-tridec-2-enyl] 6-[2-(dimethylamino)ethyl]pentadecanoate |
| SMILES | CCCCCCCCCC/C=C\COC(=O)CCCCC(CCCCCCCCC)CCN(C)C |
| InChI | InChI=1S/C32H63NO2/c1-5-7-9-11-13-14-15-16-18-20-24-30-35-32(34)27-23-22-26-31(28-29-33(3)4)25-21-19-17-12-10-8-6-2/h20,24,31H,5-19,21-23,25-30H2,1-4H3/b24-20- |
| InChIKey | PIZLDIPUUXBETL-GFMRDNFCSA-N |
| XLogP | 9.89 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.86 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|