C42H77NO5 — CID 118654376
bis[(Z)-non-2-enyl] 9-[5-(dimethylamino)-2-oxopentyl]heptadecanedioate (PubChem CID 118654376) has the molecular formula C42H77NO5 and a molecular weight of 676.08 g/mol. Its IUPAC name is bis[(Z)-non-2-enyl] 9-[5-(dimethylamino)-2-oxopentyl]heptadecanedioate.
| Compound Name | bis[(Z)-non-2-enyl] 9-[5-(dimethylamino)-2-oxopentyl]heptadecanedioate |
|---|---|
| PubChem CID | 118654376 |
| Molecular Formula | C42H77NO5 |
| Molecular Weight | 676.08 g/mol |
| Exact Mass | 675.58 |
| IUPAC Name | bis[(Z)-non-2-enyl] 9-[5-(dimethylamino)-2-oxopentyl]heptadecanedioate |
| SMILES | CCCCCC/C=C\COC(=O)CCCCCCCC(CCCCCCCC(=O)OC/C=C\CCCCCC)CC(=O)CCCN(C)C |
| InChI | InChI=1S/C42H77NO5/c1-5-7-9-11-13-21-27-36-47-41(45)33-25-19-15-17-23-30-39(38-40(44)32-29-35-43(3)4)31-24-18-16-20-26-34-42(46)48-37-28-22-14-12-10-8-6-2/h21-22,27-28,39H,5-20,23-26,29-38H2,1-4H3/b27-21-,28-22- |
| InChIKey | LOZPKJQAZBIHKK-ZDSKVHJSSA-N |
| XLogP | 11.50 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.08 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|