About non-2-enyl 8-[4-(dimethylamino)butanoyl-(8-non-2-enoxy-8-oxooctyl)phosphanyl]octanoate
non-2-enyl 8-[4-(dimethylamino)butanoyl-(8-non-2-enoxy-8-oxooctyl)phosphanyl]octanoate (PubChem CID 123887868) has the molecular formula C40H74NO5P
and a molecular weight of 680.01 g/mol. Its IUPAC name is non-2-enyl 8-[4-(dimethylamino)butanoyl-(8-non-2-enoxy-8-oxooctyl)phosphanyl]octanoate.
Molecular Properties
| Compound Name | non-2-enyl 8-[4-(dimethylamino)butanoyl-(8-non-2-enoxy-8-oxooctyl)phosphanyl]octanoate |
| PubChem CID | 123887868 |
| Molecular Formula | C40H74NO5P |
| Molecular Weight | 680.01 g/mol |
| Exact Mass | 679.53 |
| IUPAC Name | non-2-enyl 8-[4-(dimethylamino)butanoyl-(8-non-2-enoxy-8-oxooctyl)phosphanyl]octanoate |
| SMILES | CCCCCCC=CCOC(=O)CCCCCCCP(CCCCCCCC(=O)OCC=CCCCCCC)C(=O)CCCN(C)C |
| InChI | InChI=1S/C40H74NO5P/c1-5-7-9-11-13-19-25-34-45-38(42)30-23-17-15-21-27-36-47(40(44)32-29-33-41(3)4)37-28-22-16-18-24-31-39(43)46-35-26-20-14-12-10-8-6-2/h19-20,25-26H,5-18,21-24,27-37H2,1-4H3 |
| InChIKey | KSDXOZZGFIKUFB-UHFFFAOYSA-N |
| XLogP | 11.16 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 47 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 680.01 |
| LogP ≤ 5 | 11.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze non-2-enyl 8-[4-(dimethylamino)butanoyl-(8-non-2-enoxy-8-oxooctyl)phosphanyl]octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of non-2-enyl 8-[4-(dimethylamino)butanoyl-(8-non-2-enoxy-8-oxooctyl)phosphanyl]octanoate?
The IUPAC name of non-2-enyl 8-[4-(dimethylamino)butanoyl-(8-non-2-enoxy-8-oxooctyl)phosphanyl]octanoate (CID 123887868) is non-2-enyl 8-[4-(dimethylamino)butanoyl-(8-non-2-enoxy-8-oxooctyl)phosphanyl]octanoate.
What is the SMILES notation for non-2-enyl 8-[4-(dimethylamino)butanoyl-(8-non-2-enoxy-8-oxooctyl)phosphanyl]octanoate?
The canonical SMILES for non-2-enyl 8-[4-(dimethylamino)butanoyl-(8-non-2-enoxy-8-oxooctyl)phosphanyl]octanoate is CCCCCCC=CCOC(=O)CCCCCCCP(CCCCCCCC(=O)OCC=CCCCCCC)C(=O)CCCN(C)C.
What is the InChIKey of non-2-enyl 8-[4-(dimethylamino)butanoyl-(8-non-2-enoxy-8-oxooctyl)phosphanyl]octanoate?
The InChIKey is KSDXOZZGFIKUFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H74NO5P/c1-5-7-9-11-13-19-25-34-45-38(42)30-23-17-15-21-27-36-47(40(44)32-29-33-41(3)4)37-28-22-16-18-24-31-39(43)46-35-26-20-14-12-10-8-6-2/h19-20,25-26H,5-18,21-24,27-37H2,1-4H3.
What are the key properties of non-2-enyl 8-[4-(dimethylamino)butanoyl-(8-non-2-enoxy-8-oxooctyl)phosphanyl]octanoate?
non-2-enyl 8-[4-(dimethylamino)butanoyl-(8-non-2-enoxy-8-oxooctyl)phosphanyl]octanoate has a molecular weight of 680.01 g/mol, XLogP of 11.16, 35 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for non-2-enyl 8-[4-(dimethylamino)butanoyl-(8-non-2-enoxy-8-oxooctyl)phosphanyl]octanoate is sourced from PubChem (CID 123887868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).