C56H106NO5P — CID 123477830
5-hexylundec-2-enyl 8-[4-(dimethylamino)butanoyl-[8-(5-hexylundec-2-enoxy)-8-oxooctyl]phosphanyl]octanoate (PubChem CID 123477830) has the molecular formula C56H106NO5P and a molecular weight of 904.44 g/mol. Its IUPAC name is 5-hexylundec-2-enyl 8-[4-(dimethylamino)butanoyl-[8-(5-hexylundec-2-enoxy)-8-oxooctyl]phosphanyl]octanoate.
| Compound Name | 5-hexylundec-2-enyl 8-[4-(dimethylamino)butanoyl-[8-(5-hexylundec-2-enoxy)-8-oxooctyl]phosphanyl]octanoate |
|---|---|
| PubChem CID | 123477830 |
| Molecular Formula | C56H106NO5P |
| Molecular Weight | 904.44 g/mol |
| Exact Mass | 903.78 |
| IUPAC Name | 5-hexylundec-2-enyl 8-[4-(dimethylamino)butanoyl-[8-(5-hexylundec-2-enoxy)-8-oxooctyl]phosphanyl]octanoate |
| SMILES | CCCCCCC(CC=CCOC(=O)CCCCCCCP(CCCCCCCC(=O)OCC=CCC(CCCCCC)CCCCCC)C(=O)CCCN(C)C)CCCCCC |
| InChI | InChI=1S/C56H106NO5P/c1-7-11-15-25-38-52(39-26-16-12-8-2)42-31-33-48-61-54(58)44-29-21-19-23-35-50-63(56(60)46-37-47-57(5)6)51-36-24-20-22-30-45-55(59)62-49-34-32-43-53(40-27-17-13-9-3)41-28-18-14-10-4/h31-34,52-53H,7-30,35-51H2,1-6H3 |
| InChIKey | QDMZDJJFPOIGTJ-UHFFFAOYSA-N |
| XLogP | 17.11 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 49 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.44 |
| LogP ≤ 5 | 17.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|