C54H104N2O4 — CID 123790873
4-pentylnon-2-enyl 10-[4-(dimethylamino)butyl-[10-oxo-10-(4-pentylnon-2-enoxy)decyl]amino]decanoate (PubChem CID 123790873) has the molecular formula C54H104N2O4 and a molecular weight of 845.44 g/mol. Its IUPAC name is 4-pentylnon-2-enyl 10-[4-(dimethylamino)butyl-[10-oxo-10-(4-pentylnon-2-enoxy)decyl]amino]decanoate.
| Compound Name | 4-pentylnon-2-enyl 10-[4-(dimethylamino)butyl-[10-oxo-10-(4-pentylnon-2-enoxy)decyl]amino]decanoate |
|---|---|
| PubChem CID | 123790873 |
| Molecular Formula | C54H104N2O4 |
| Molecular Weight | 845.44 g/mol |
| Exact Mass | 844.80 |
| IUPAC Name | 4-pentylnon-2-enyl 10-[4-(dimethylamino)butyl-[10-oxo-10-(4-pentylnon-2-enoxy)decyl]amino]decanoate |
| SMILES | CCCCCC(C=CCOC(=O)CCCCCCCCCN(CCCCCCCCCC(=O)OCC=CC(CCCCC)CCCCC)CCCCN(C)C)CCCCC |
| InChI | InChI=1S/C54H104N2O4/c1-7-11-25-37-51(38-26-12-8-2)41-35-49-59-53(57)43-29-21-17-15-19-23-31-46-56(48-34-33-45-55(5)6)47-32-24-20-16-18-22-30-44-54(58)60-50-36-42-52(39-27-13-9-3)40-28-14-10-4/h35-36,41-42,51-52H,7-34,37-40,43-50H2,1-6H3 |
| InChIKey | FMEGSNAPASOUDD-UHFFFAOYSA-N |
| XLogP | 15.62 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.44 |
| LogP ≤ 5 | 15.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|