About bis(4-pentylnonyl) 11-[6-(dimethylamino)hexyl]henicosanedioate
bis(4-pentylnonyl) 11-[6-(dimethylamino)hexyl]henicosanedioate (PubChem CID 167633857) has the molecular formula C57H113NO4
and a molecular weight of 876.53 g/mol. Its IUPAC name is bis(4-pentylnonyl) 11-[6-(dimethylamino)hexyl]henicosanedioate.
Molecular Properties
| Compound Name | bis(4-pentylnonyl) 11-[6-(dimethylamino)hexyl]henicosanedioate |
| PubChem CID | 167633857 |
| Molecular Formula | C57H113NO4 |
| Molecular Weight | 876.53 g/mol |
| Exact Mass | 875.87 |
| IUPAC Name | bis(4-pentylnonyl) 11-[6-(dimethylamino)hexyl]henicosanedioate |
| SMILES | CCCCCC(CCCCC)CCCOC(=O)CCCCCCCCCC(CCCCCCCCCC(=O)OCCCC(CCCCC)CCCCC)CCCCCCN(C)C |
| InChI | InChI=1S/C57H113NO4/c1-7-11-27-39-54(40-28-12-8-2)46-37-51-61-56(59)48-34-23-19-15-17-21-31-43-53(45-33-25-26-36-50-58(5)6)44-32-22-18-16-20-24-35-49-57(60)62-52-38-47-55(41-29-13-9-3)42-30-14-10-4/h53-55H,7-52H2,1-6H3 |
| InChIKey | HJIBXJUABHQWLX-UHFFFAOYSA-N |
| XLogP | 18.34 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 62 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 876.53 |
| LogP ≤ 5 | 18.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis(4-pentylnonyl) 11-[6-(dimethylamino)hexyl]henicosanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-pentylnonyl) 11-[6-(dimethylamino)hexyl]henicosanedioate?
The IUPAC name of bis(4-pentylnonyl) 11-[6-(dimethylamino)hexyl]henicosanedioate (CID 167633857) is bis(4-pentylnonyl) 11-[6-(dimethylamino)hexyl]henicosanedioate.
What is the SMILES notation for bis(4-pentylnonyl) 11-[6-(dimethylamino)hexyl]henicosanedioate?
The canonical SMILES for bis(4-pentylnonyl) 11-[6-(dimethylamino)hexyl]henicosanedioate is CCCCCC(CCCCC)CCCOC(=O)CCCCCCCCCC(CCCCCCCCCC(=O)OCCCC(CCCCC)CCCCC)CCCCCCN(C)C.
What is the InChIKey of bis(4-pentylnonyl) 11-[6-(dimethylamino)hexyl]henicosanedioate?
The InChIKey is HJIBXJUABHQWLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C57H113NO4/c1-7-11-27-39-54(40-28-12-8-2)46-37-51-61-56(59)48-34-23-19-15-17-21-31-43-53(45-33-25-26-36-50-58(5)6)44-32-22-18-16-20-24-35-49-57(60)62-52-38-47-55(41-29-13-9-3)42-30-14-10-4/h53-55H,7-52H2,1-6H3.
What are the key properties of bis(4-pentylnonyl) 11-[6-(dimethylamino)hexyl]henicosanedioate?
bis(4-pentylnonyl) 11-[6-(dimethylamino)hexyl]henicosanedioate has a molecular weight of 876.53 g/mol, XLogP of 18.34, 51 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-pentylnonyl) 11-[6-(dimethylamino)hexyl]henicosanedioate is sourced from PubChem (CID 167633857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).