About 1-O-(4-butylnonyl) 17-O-(4-pentylnonyl) 9-[4-(dimethylamino)butyl]heptadecanedioate
1-O-(4-butylnonyl) 17-O-(4-pentylnonyl) 9-[4-(dimethylamino)butyl]heptadecanedioate (PubChem CID 170101276) has the molecular formula C50H99NO4
and a molecular weight of 778.34 g/mol. Its IUPAC name is 1-O-(4-butylnonyl) 17-O-(4-pentylnonyl) 9-[4-(dimethylamino)butyl]heptadecanedioate.
Molecular Properties
| Compound Name | 1-O-(4-butylnonyl) 17-O-(4-pentylnonyl) 9-[4-(dimethylamino)butyl]heptadecanedioate |
| PubChem CID | 170101276 |
| Molecular Formula | C50H99NO4 |
| Molecular Weight | 778.34 g/mol |
| Exact Mass | 777.76 |
| IUPAC Name | 1-O-(4-butylnonyl) 17-O-(4-pentylnonyl) 9-[4-(dimethylamino)butyl]heptadecanedioate |
| SMILES | CCCCCC(CCCC)CCCOC(=O)CCCCCCCC(CCCCCCCC(=O)OCCCC(CCCCC)CCCCC)CCCCN(C)C |
| InChI | InChI=1S/C50H99NO4/c1-7-11-21-33-46(32-14-10-4)39-30-44-54-49(52)41-26-19-15-17-24-36-47(38-28-29-43-51(5)6)37-25-18-16-20-27-42-50(53)55-45-31-40-48(34-22-12-8-2)35-23-13-9-3/h46-48H,7-45H2,1-6H3 |
| InChIKey | VWNCTVODLQWATI-UHFFFAOYSA-N |
| XLogP | 15.61 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 55 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 778.34 |
| LogP ≤ 5 | 15.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-O-(4-butylnonyl) 17-O-(4-pentylnonyl) 9-[4-(dimethylamino)butyl]heptadecanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-(4-butylnonyl) 17-O-(4-pentylnonyl) 9-[4-(dimethylamino)butyl]heptadecanedioate?
The IUPAC name of 1-O-(4-butylnonyl) 17-O-(4-pentylnonyl) 9-[4-(dimethylamino)butyl]heptadecanedioate (CID 170101276) is 1-O-(4-butylnonyl) 17-O-(4-pentylnonyl) 9-[4-(dimethylamino)butyl]heptadecanedioate.
What is the SMILES notation for 1-O-(4-butylnonyl) 17-O-(4-pentylnonyl) 9-[4-(dimethylamino)butyl]heptadecanedioate?
The canonical SMILES for 1-O-(4-butylnonyl) 17-O-(4-pentylnonyl) 9-[4-(dimethylamino)butyl]heptadecanedioate is CCCCCC(CCCC)CCCOC(=O)CCCCCCCC(CCCCCCCC(=O)OCCCC(CCCCC)CCCCC)CCCCN(C)C.
What is the InChIKey of 1-O-(4-butylnonyl) 17-O-(4-pentylnonyl) 9-[4-(dimethylamino)butyl]heptadecanedioate?
The InChIKey is VWNCTVODLQWATI-UHFFFAOYSA-N. The full InChI is InChI=1S/C50H99NO4/c1-7-11-21-33-46(32-14-10-4)39-30-44-54-49(52)41-26-19-15-17-24-36-47(38-28-29-43-51(5)6)37-25-18-16-20-27-42-50(53)55-45-31-40-48(34-22-12-8-2)35-23-13-9-3/h46-48H,7-45H2,1-6H3.
What are the key properties of 1-O-(4-butylnonyl) 17-O-(4-pentylnonyl) 9-[4-(dimethylamino)butyl]heptadecanedioate?
1-O-(4-butylnonyl) 17-O-(4-pentylnonyl) 9-[4-(dimethylamino)butyl]heptadecanedioate has a molecular weight of 778.34 g/mol, XLogP of 15.61, 44 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-(4-butylnonyl) 17-O-(4-pentylnonyl) 9-[4-(dimethylamino)butyl]heptadecanedioate is sourced from PubChem (CID 170101276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).