C42H79NO4 — CID 167577890
bis[(Z)-non-3-enyl] 9-[5-(dimethylamino)pentyl]heptadecanedioate (PubChem CID 167577890) has the molecular formula C42H79NO4 and a molecular weight of 662.10 g/mol. Its IUPAC name is bis[(Z)-non-3-enyl] 9-[5-(dimethylamino)pentyl]heptadecanedioate.
| Compound Name | bis[(Z)-non-3-enyl] 9-[5-(dimethylamino)pentyl]heptadecanedioate |
|---|---|
| PubChem CID | 167577890 |
| Molecular Formula | C42H79NO4 |
| Molecular Weight | 662.10 g/mol |
| Exact Mass | 661.60 |
| IUPAC Name | bis[(Z)-non-3-enyl] 9-[5-(dimethylamino)pentyl]heptadecanedioate |
| SMILES | CCCCC/C=C\CCOC(=O)CCCCCCCC(CCCCCCCC(=O)OCC/C=C\CCCCC)CCCCCN(C)C |
| InChI | InChI=1S/C42H79NO4/c1-5-7-9-11-13-21-30-38-46-41(44)35-27-19-15-17-24-32-40(34-26-23-29-37-43(3)4)33-25-18-16-20-28-36-42(45)47-39-31-22-14-12-10-8-6-2/h13-14,21-22,40H,5-12,15-20,23-39H2,1-4H3/b21-13-,22-14- |
| InChIKey | CEEHTUZTEYKRBA-JZTLMNBPSA-N |
| XLogP | 12.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.10 |
| LogP ≤ 5 | 12.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|