C50H98N2O4 — CID 169107812
3-hexylnonyl 8-[[(Z)-dec-3-enoxy]-[5-(dimethylamino)pentanoyl]amino]octadecanoate (PubChem CID 169107812) has the molecular formula C50H98N2O4 and a molecular weight of 791.34 g/mol. Its IUPAC name is 3-hexylnonyl 8-[[(Z)-dec-3-enoxy]-[5-(dimethylamino)pentanoyl]amino]octadecanoate.
| Compound Name | 3-hexylnonyl 8-[[(Z)-dec-3-enoxy]-[5-(dimethylamino)pentanoyl]amino]octadecanoate |
|---|---|
| PubChem CID | 169107812 |
| Molecular Formula | C50H98N2O4 |
| Molecular Weight | 791.34 g/mol |
| Exact Mass | 790.75 |
| IUPAC Name | 3-hexylnonyl 8-[[(Z)-dec-3-enoxy]-[5-(dimethylamino)pentanoyl]amino]octadecanoate |
| SMILES | CCCCCC/C=C\CCON(C(=O)CCCCN(C)C)C(CCCCCCCCCC)CCCCCCC(=O)OCCC(CCCCCC)CCCCCC |
| InChI | InChI=1S/C50H98N2O4/c1-7-11-15-19-21-23-25-31-39-48(52(49(53)41-34-35-44-51(5)6)56-45-36-28-24-22-20-16-12-8-2)40-32-26-27-33-42-50(54)55-46-43-47(37-29-17-13-9-3)38-30-18-14-10-4/h24,28,47-48H,7-23,25-27,29-46H2,1-6H3/b28-24- |
| InChIKey | DVODHQHYYPCUSS-COOPMVRXSA-N |
| XLogP | 15.13 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.34 |
| LogP ≤ 5 | 15.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|