C34H68N2O2 — CID 170086510
N-[(Z)-dec-3-enoxy]-4-(dimethylamino)-N-octadecan-8-ylbutanamide (PubChem CID 170086510) has the molecular formula C34H68N2O2 and a molecular weight of 536.93 g/mol. Its IUPAC name is N-[(Z)-dec-3-enoxy]-4-(dimethylamino)-N-octadecan-8-ylbutanamide.
| Compound Name | N-[(Z)-dec-3-enoxy]-4-(dimethylamino)-N-octadecan-8-ylbutanamide |
|---|---|
| PubChem CID | 170086510 |
| Molecular Formula | C34H68N2O2 |
| Molecular Weight | 536.93 g/mol |
| Exact Mass | 536.53 |
| IUPAC Name | N-[(Z)-dec-3-enoxy]-4-(dimethylamino)-N-octadecan-8-ylbutanamide |
| SMILES | CCCCCC/C=C\CCON(C(=O)CCCN(C)C)C(CCCCCCC)CCCCCCCCCC |
| InChI | InChI=1S/C34H68N2O2/c1-6-9-12-15-17-19-22-25-29-33(28-24-21-14-11-8-3)36(34(37)30-27-31-35(4)5)38-32-26-23-20-18-16-13-10-7-2/h20,23,33H,6-19,21-22,24-32H2,1-5H3/b23-20- |
| InChIKey | MCEVYEOIECXJKL-ATJXCDBQSA-N |
| XLogP | 10.27 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.93 |
| LogP ≤ 5 | 10.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|