C72H140F2N4O8 — CID 175930978
ethyl 9-[decoxy-[4-(dimethylamino)butanoyl]amino]-2-fluorooctadecanoate;ethyl (Z)-9-[decoxy-[4-(dimethylamino)butanoyl]amino]-2-fluorooctadec-2-enoate (PubChem CID 175930978) has the molecular formula C72H140F2N4O8 and a molecular weight of 1227.93 g/mol. Its IUPAC name is ethyl 9-[decoxy-[4-(dimethylamino)butanoyl]amino]-2-fluorooctadecanoate;ethyl (Z)-9-[decoxy-[4-(dimethylamino)butanoyl]amino]-2-fluorooctadec-2-enoate.
| Compound Name | ethyl 9-[decoxy-[4-(dimethylamino)butanoyl]amino]-2-fluorooctadecanoate;ethyl (Z)-9-[decoxy-[4-(dimethylamino)butanoyl]amino]-2-fluorooctadec-2-enoate |
|---|---|
| PubChem CID | 175930978 |
| Molecular Formula | C72H140F2N4O8 |
| Molecular Weight | 1227.93 g/mol |
| Exact Mass | 1227.06 |
| IUPAC Name | ethyl 9-[decoxy-[4-(dimethylamino)butanoyl]amino]-2-fluorooctadecanoate;ethyl (Z)-9-[decoxy-[4-(dimethylamino)butanoyl]amino]-2-fluorooctadec-2-enoate |
| SMILES | CCCCCCCCCCON(C(=O)CCCN(C)C)C(CCCCC/C=C(\F)C(=O)OCC)CCCCCCCCC.CCCCCCCCCCON(C(=O)CCCN(C)C)C(CCCCCCCCC)CCCCCCC(F)C(=O)OCC |
| InChI | InChI=1S/C36H71FN2O4.C36H69FN2O4/c2*1-6-9-11-13-15-17-21-25-32-43-39(35(40)30-26-31-38(4)5)33(27-22-18-16-14-12-10-7-2)28-23-19-20-24-29-34(37)36(41)42-8-3/h33-34H,6-32H2,1-5H3;29,33H,6-28,30-32H2,1-5H3/b;34-29- |
| InChIKey | JPSINYOWHUTEOQ-PIYSVNSESA-N |
| XLogP | 20.09 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 63 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1227.93 |
| LogP ≤ 5 | 20.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|