About 9-[4-(dimethylamino)butoxy-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate
9-[4-(dimethylamino)butoxy-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate (PubChem CID 134498199) has the molecular formula C56H112N2O5
and a molecular weight of 893.52 g/mol. Its IUPAC name is 9-[4-(dimethylamino)butoxy-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate.
Molecular Properties
| Compound Name | 9-[4-(dimethylamino)butoxy-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate |
| PubChem CID | 134498199 |
| Molecular Formula | C56H112N2O5 |
| Molecular Weight | 893.52 g/mol |
| Exact Mass | 892.86 |
| IUPAC Name | 9-[4-(dimethylamino)butoxy-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCCCCCCN(CCCCCCCCCOC(=O)C(CCCCCC)CCCCCCCC)OCCCCN(C)C |
| InChI | InChI=1S/C56H112N2O5/c1-7-11-15-19-27-35-45-53(43-33-17-13-9-3)55(59)61-50-40-31-25-21-23-29-37-48-58(63-52-42-39-47-57(5)6)49-38-30-24-22-26-32-41-51-62-56(60)54(44-34-18-14-10-4)46-36-28-20-16-12-8-2/h53-54H,7-52H2,1-6H3 |
| InChIKey | HCRPVQUQTBJXRD-UHFFFAOYSA-N |
| XLogP | 16.78 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 63 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 893.52 |
| LogP ≤ 5 | 16.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-[4-(dimethylamino)butoxy-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[4-(dimethylamino)butoxy-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate?
The IUPAC name of 9-[4-(dimethylamino)butoxy-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate (CID 134498199) is 9-[4-(dimethylamino)butoxy-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate.
What is the SMILES notation for 9-[4-(dimethylamino)butoxy-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate?
The canonical SMILES for 9-[4-(dimethylamino)butoxy-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate is CCCCCCCCC(CCCCCC)C(=O)OCCCCCCCCCN(CCCCCCCCCOC(=O)C(CCCCCC)CCCCCCCC)OCCCCN(C)C.
What is the InChIKey of 9-[4-(dimethylamino)butoxy-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate?
The InChIKey is HCRPVQUQTBJXRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C56H112N2O5/c1-7-11-15-19-27-35-45-53(43-33-17-13-9-3)55(59)61-50-40-31-25-21-23-29-37-48-58(63-52-42-39-47-57(5)6)49-38-30-24-22-26-32-41-51-62-56(60)54(44-34-18-14-10-4)46-36-28-20-16-12-8-2/h53-54H,7-52H2,1-6H3.
What are the key properties of 9-[4-(dimethylamino)butoxy-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate?
9-[4-(dimethylamino)butoxy-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate has a molecular weight of 893.52 g/mol, XLogP of 16.78, 52 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[4-(dimethylamino)butoxy-[9-(2-hexyldecanoyloxy)nonyl]amino]nonyl 2-hexyldecanoate is sourced from PubChem (CID 134498199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).