About 3-(dimethylamino)propyl 2-butylheptanoate
3-(dimethylamino)propyl 2-butylheptanoate (PubChem CID 90858053) has the molecular formula C16H33NO2
and a molecular weight of 271.44 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 2-butylheptanoate.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl 2-butylheptanoate |
| PubChem CID | 90858053 |
| Molecular Formula | C16H33NO2 |
| Molecular Weight | 271.44 g/mol |
| Exact Mass | 271.25 |
| IUPAC Name | 3-(dimethylamino)propyl 2-butylheptanoate |
| SMILES | CCCCCC(CCCC)C(=O)OCCCN(C)C |
| InChI | InChI=1S/C16H33NO2/c1-5-7-9-12-15(11-8-6-2)16(18)19-14-10-13-17(3)4/h15H,5-14H2,1-4H3 |
| InChIKey | LRUFXVYHNHAEHB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl 2-butylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl 2-butylheptanoate?
The IUPAC name of 3-(dimethylamino)propyl 2-butylheptanoate (CID 90858053) is 3-(dimethylamino)propyl 2-butylheptanoate.
What is the SMILES notation for 3-(dimethylamino)propyl 2-butylheptanoate?
The canonical SMILES for 3-(dimethylamino)propyl 2-butylheptanoate is CCCCCC(CCCC)C(=O)OCCCN(C)C.
What is the InChIKey of 3-(dimethylamino)propyl 2-butylheptanoate?
The InChIKey is LRUFXVYHNHAEHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO2/c1-5-7-9-12-15(11-8-6-2)16(18)19-14-10-13-17(3)4/h15H,5-14H2,1-4H3.
What are the key properties of 3-(dimethylamino)propyl 2-butylheptanoate?
3-(dimethylamino)propyl 2-butylheptanoate has a molecular weight of 271.44 g/mol, XLogP of 3.87, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl 2-butylheptanoate is sourced from PubChem (CID 90858053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).