About 3-(dimethylamino)propyl 2-butyloctanoate
3-(dimethylamino)propyl 2-butyloctanoate (PubChem CID 139372197) has the molecular formula C17H35NO2
and a molecular weight of 285.47 g/mol. Its IUPAC name is 3-(dimethylamino)propyl 2-butyloctanoate.
Molecular Properties
| Compound Name | 3-(dimethylamino)propyl 2-butyloctanoate |
| PubChem CID | 139372197 |
| Molecular Formula | C17H35NO2 |
| Molecular Weight | 285.47 g/mol |
| Exact Mass | 285.27 |
| IUPAC Name | 3-(dimethylamino)propyl 2-butyloctanoate |
| SMILES | CCCCCCC(CCCC)C(=O)OCCCN(C)C |
| InChI | InChI=1S/C17H35NO2/c1-5-7-9-10-13-16(12-8-6-2)17(19)20-15-11-14-18(3)4/h16H,5-15H2,1-4H3 |
| InChIKey | CEFRYTPOEXWSMQ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(dimethylamino)propyl 2-butyloctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(dimethylamino)propyl 2-butyloctanoate?
The IUPAC name of 3-(dimethylamino)propyl 2-butyloctanoate (CID 139372197) is 3-(dimethylamino)propyl 2-butyloctanoate.
What is the SMILES notation for 3-(dimethylamino)propyl 2-butyloctanoate?
The canonical SMILES for 3-(dimethylamino)propyl 2-butyloctanoate is CCCCCCC(CCCC)C(=O)OCCCN(C)C.
What is the InChIKey of 3-(dimethylamino)propyl 2-butyloctanoate?
The InChIKey is CEFRYTPOEXWSMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H35NO2/c1-5-7-9-10-13-16(12-8-6-2)17(19)20-15-11-14-18(3)4/h16H,5-15H2,1-4H3.
What are the key properties of 3-(dimethylamino)propyl 2-butyloctanoate?
3-(dimethylamino)propyl 2-butyloctanoate has a molecular weight of 285.47 g/mol, XLogP of 4.26, 13 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(dimethylamino)propyl 2-butyloctanoate is sourced from PubChem (CID 139372197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).