C30H59N3O4 — CID 170643425
[5-[3-[4-(dimethylamino)butanoylamino]propylamino]-5-oxopentyl] 2-hexyldecanoate (PubChem CID 170643425) has the molecular formula C30H59N3O4 and a molecular weight of 525.82 g/mol. Its IUPAC name is [5-[3-[4-(dimethylamino)butanoylamino]propylamino]-5-oxopentyl] 2-hexyldecanoate.
| Compound Name | [5-[3-[4-(dimethylamino)butanoylamino]propylamino]-5-oxopentyl] 2-hexyldecanoate |
|---|---|
| PubChem CID | 170643425 |
| Molecular Formula | C30H59N3O4 |
| Molecular Weight | 525.82 g/mol |
| Exact Mass | 525.45 |
| IUPAC Name | [5-[3-[4-(dimethylamino)butanoylamino]propylamino]-5-oxopentyl] 2-hexyldecanoate |
| SMILES | CCCCCCCCC(CCCCCC)C(=O)OCCCCC(=O)NCCCNC(=O)CCCN(C)C |
| InChI | InChI=1S/C30H59N3O4/c1-5-7-9-11-12-14-20-27(19-13-10-8-6-2)30(36)37-26-16-15-21-28(34)31-23-18-24-32-29(35)22-17-25-33(3)4/h27H,5-26H2,1-4H3,(H,31,34)(H,32,35) |
| InChIKey | BWFJOCMVDOQBOJ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.82 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|