C39H77NO4 — CID 166117799
3-octylundecyl 7-[4-(dimethylamino)butanoyloxy]tetradecanoate (PubChem CID 166117799) has the molecular formula C39H77NO4 and a molecular weight of 624.05 g/mol. Its IUPAC name is 3-octylundecyl 7-[4-(dimethylamino)butanoyloxy]tetradecanoate.
| Compound Name | 3-octylundecyl 7-[4-(dimethylamino)butanoyloxy]tetradecanoate |
|---|---|
| PubChem CID | 166117799 |
| Molecular Formula | C39H77NO4 |
| Molecular Weight | 624.05 g/mol |
| Exact Mass | 623.59 |
| IUPAC Name | 3-octylundecyl 7-[4-(dimethylamino)butanoyloxy]tetradecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)CCOC(=O)CCCCCC(CCCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C39H77NO4/c1-6-9-12-15-18-21-27-36(28-22-19-16-13-10-7-2)33-35-43-38(41)31-25-20-24-30-37(29-23-17-14-11-8-3)44-39(42)32-26-34-40(4)5/h36-37H,6-35H2,1-5H3 |
| InChIKey | QEQMRZZPIGDUML-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.05 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|