C49H91NO10 — CID 170167084
9-O-[2-[4-(dimethylamino)butanoyloxy]-3-[6-(2-hexyldecoxy)-6-oxohexanoyl]oxypropyl] 1-O-nonyl nonanedioate (PubChem CID 170167084) has the molecular formula C49H91NO10 and a molecular weight of 854.26 g/mol. Its IUPAC name is 9-O-[2-[4-(dimethylamino)butanoyloxy]-3-[6-(2-hexyldecoxy)-6-oxohexanoyl]oxypropyl] 1-O-nonyl nonanedioate.
| Compound Name | 9-O-[2-[4-(dimethylamino)butanoyloxy]-3-[6-(2-hexyldecoxy)-6-oxohexanoyl]oxypropyl] 1-O-nonyl nonanedioate |
|---|---|
| PubChem CID | 170167084 |
| Molecular Formula | C49H91NO10 |
| Molecular Weight | 854.26 g/mol |
| Exact Mass | 853.66 |
| IUPAC Name | 9-O-[2-[4-(dimethylamino)butanoyloxy]-3-[6-(2-hexyldecoxy)-6-oxohexanoyl]oxypropyl] 1-O-nonyl nonanedioate |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCC(=O)OCC(COC(=O)CCCCC(=O)OCC(CCCCCC)CCCCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C49H91NO10/c1-6-9-12-15-17-22-29-39-56-45(51)33-25-20-18-21-26-34-47(53)58-41-44(60-49(55)37-30-38-50(4)5)42-59-48(54)36-28-27-35-46(52)57-40-43(31-23-14-11-8-3)32-24-19-16-13-10-7-2/h43-44H,6-42H2,1-5H3 |
| InChIKey | JLTDUBBGOJAOLF-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 854.26 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|