C52H97NO10 — CID 175445247
1-O-(2-butyloctyl) 8-O-[2-[4-(dimethylamino)butanoyloxy]-3-[7-(2-hexyldecoxy)-7-oxoheptanoyl]oxypropyl] octanedioate (PubChem CID 175445247) has the molecular formula C52H97NO10 and a molecular weight of 896.34 g/mol. Its IUPAC name is 1-O-(2-butyloctyl) 8-O-[2-[4-(dimethylamino)butanoyloxy]-3-[7-(2-hexyldecoxy)-7-oxoheptanoyl]oxypropyl] octanedioate.
| Compound Name | 1-O-(2-butyloctyl) 8-O-[2-[4-(dimethylamino)butanoyloxy]-3-[7-(2-hexyldecoxy)-7-oxoheptanoyl]oxypropyl] octanedioate |
|---|---|
| PubChem CID | 175445247 |
| Molecular Formula | C52H97NO10 |
| Molecular Weight | 896.34 g/mol |
| Exact Mass | 895.71 |
| IUPAC Name | 1-O-(2-butyloctyl) 8-O-[2-[4-(dimethylamino)butanoyloxy]-3-[7-(2-hexyldecoxy)-7-oxoheptanoyl]oxypropyl] octanedioate |
| SMILES | CCCCCCCCC(CCCCCC)COC(=O)CCCCCC(=O)OCC(COC(=O)CCCCCCC(=O)OCC(CCCC)CCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C52H97NO10/c1-7-11-15-18-19-25-34-46(33-24-17-13-9-3)42-60-49(55)37-28-22-29-38-51(57)62-44-47(63-52(58)39-30-40-53(5)6)43-61-50(56)36-27-21-20-26-35-48(54)59-41-45(31-14-10-4)32-23-16-12-8-2/h45-47H,7-44H2,1-6H3 |
| InChIKey | TWMSVHGGBSUNHY-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 63 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 896.34 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|