C48H93NO6 — CID 176756084
2-heptylnonyl 8-[4-(dimethylamino)butanoyloxy]-14,14-dimethyl-15-nonanoyloxypentadecanoate (PubChem CID 176756084) has the molecular formula C48H93NO6 and a molecular weight of 780.27 g/mol. Its IUPAC name is 2-heptylnonyl 8-[4-(dimethylamino)butanoyloxy]-14,14-dimethyl-15-nonanoyloxypentadecanoate.
| Compound Name | 2-heptylnonyl 8-[4-(dimethylamino)butanoyloxy]-14,14-dimethyl-15-nonanoyloxypentadecanoate |
|---|---|
| PubChem CID | 176756084 |
| Molecular Formula | C48H93NO6 |
| Molecular Weight | 780.27 g/mol |
| Exact Mass | 779.70 |
| IUPAC Name | 2-heptylnonyl 8-[4-(dimethylamino)butanoyloxy]-14,14-dimethyl-15-nonanoyloxypentadecanoate |
| SMILES | CCCCCCCCC(=O)OCC(C)(C)CCCCCC(CCCCCCC(=O)OCC(CCCCCCC)CCCCCCC)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C48H93NO6/c1-8-11-14-17-20-28-37-46(51)54-42-48(4,5)39-30-23-27-35-44(55-47(52)38-31-40-49(6)7)34-26-21-22-29-36-45(50)53-41-43(32-24-18-15-12-9-2)33-25-19-16-13-10-3/h43-44H,8-42H2,1-7H3 |
| InChIKey | XIIVNZZVHKQTLH-UHFFFAOYSA-N |
| XLogP | 13.73 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.27 |
| LogP ≤ 5 | 13.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|