C32H61NO6 — CID 176756142
14-decanoyloxy-8-[4-(dimethylamino)butanoyloxy]-13,13-dimethyltetradecanoic acid (PubChem CID 176756142) has the molecular formula C32H61NO6 and a molecular weight of 555.84 g/mol. Its IUPAC name is 14-decanoyloxy-8-[4-(dimethylamino)butanoyloxy]-13,13-dimethyltetradecanoic acid.
| Compound Name | 14-decanoyloxy-8-[4-(dimethylamino)butanoyloxy]-13,13-dimethyltetradecanoic acid |
|---|---|
| PubChem CID | 176756142 |
| Molecular Formula | C32H61NO6 |
| Molecular Weight | 555.84 g/mol |
| Exact Mass | 555.45 |
| IUPAC Name | 14-decanoyloxy-8-[4-(dimethylamino)butanoyloxy]-13,13-dimethyltetradecanoic acid |
| SMILES | CCCCCCCCCC(=O)OCC(C)(C)CCCCC(CCCCCCC(=O)O)OC(=O)CCCN(C)C |
| InChI | InChI=1S/C32H61NO6/c1-6-7-8-9-10-11-16-23-30(36)38-27-32(2,3)25-18-17-21-28(20-14-12-13-15-22-29(34)35)39-31(37)24-19-26-33(4)5/h28H,6-27H2,1-5H3,(H,34,35) |
| InChIKey | SAZGQHQWAQXGAA-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.84 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|