C59H107NO14 — CID 170176465
1-O-[2-[4-(dimethylamino)butanoyloxymethyl]-3-(3-oxo-3-tridecan-7-yloxypropanoyl)oxy-2-[(3-oxo-3-tridecan-7-yloxypropanoyl)oxymethyl]propyl] 3-O-tridecan-7-yl propanedioate (PubChem CID 170176465) has the molecular formula C59H107NO14 and a molecular weight of 1054.50 g/mol. Its IUPAC name is 1-O-[2-[4-(dimethylamino)butanoyloxymethyl]-3-(3-oxo-3-tridecan-7-yloxypropanoyl)oxy-2-[(3-oxo-3-tridecan-7-yloxypropanoyl)oxymethyl]propyl] 3-O-tridecan-7-yl propanedioate.
| Compound Name | 1-O-[2-[4-(dimethylamino)butanoyloxymethyl]-3-(3-oxo-3-tridecan-7-yloxypropanoyl)oxy-2-[(3-oxo-3-tridecan-7-yloxypropanoyl)oxymethyl]propyl] 3-O-tridecan-7-yl propanedioate |
|---|---|
| PubChem CID | 170176465 |
| Molecular Formula | C59H107NO14 |
| Molecular Weight | 1054.50 g/mol |
| Exact Mass | 1053.77 |
| IUPAC Name | 1-O-[2-[4-(dimethylamino)butanoyloxymethyl]-3-(3-oxo-3-tridecan-7-yloxypropanoyl)oxy-2-[(3-oxo-3-tridecan-7-yloxypropanoyl)oxymethyl]propyl] 3-O-tridecan-7-yl propanedioate |
| SMILES | CCCCCCC(CCCCCC)OC(=O)CC(=O)OCC(COC(=O)CCCN(C)C)(COC(=O)CC(=O)OC(CCCCCC)CCCCCC)COC(=O)CC(=O)OC(CCCCCC)CCCCCC |
| InChI | InChI=1S/C59H107NO14/c1-9-15-21-27-34-49(35-28-22-16-10-2)72-56(65)42-53(62)69-46-59(45-68-52(61)40-33-41-60(7)8,47-70-54(63)43-57(66)73-50(36-29-23-17-11-3)37-30-24-18-12-4)48-71-55(64)44-58(67)74-51(38-31-25-19-13-5)39-32-26-20-14-6/h49-51H,9-48H2,1-8H3 |
| InChIKey | JEOZAIQGBMESCM-UHFFFAOYSA-N |
| XLogP | 13.22 |
| TPSA | 187.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 74 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1054.50 |
| LogP ≤ 5 | 13.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|