C51H95NO10 — CID 170176272
6-O-[2-[4-(dimethylamino)butanoyloxymethyl]-3-(3-pentyloctanoyloxy)-2-(3-pentyloctanoyloxymethyl)propyl] 1-O-octyl hexanedioate (PubChem CID 170176272) has the molecular formula C51H95NO10 and a molecular weight of 882.32 g/mol. Its IUPAC name is 6-O-[2-[4-(dimethylamino)butanoyloxymethyl]-3-(3-pentyloctanoyloxy)-2-(3-pentyloctanoyloxymethyl)propyl] 1-O-octyl hexanedioate.
| Compound Name | 6-O-[2-[4-(dimethylamino)butanoyloxymethyl]-3-(3-pentyloctanoyloxy)-2-(3-pentyloctanoyloxymethyl)propyl] 1-O-octyl hexanedioate |
|---|---|
| PubChem CID | 170176272 |
| Molecular Formula | C51H95NO10 |
| Molecular Weight | 882.32 g/mol |
| Exact Mass | 881.70 |
| IUPAC Name | 6-O-[2-[4-(dimethylamino)butanoyloxymethyl]-3-(3-pentyloctanoyloxy)-2-(3-pentyloctanoyloxymethyl)propyl] 1-O-octyl hexanedioate |
| SMILES | CCCCCCCCOC(=O)CCCCC(=O)OCC(COC(=O)CCCN(C)C)(COC(=O)CC(CCCCC)CCCCC)COC(=O)CC(CCCCC)CCCCC |
| InChI | InChI=1S/C51H95NO10/c1-8-13-18-19-20-27-37-58-46(53)33-25-26-34-47(54)59-40-51(41-60-48(55)35-28-36-52(6)7,42-61-49(56)38-44(29-21-14-9-2)30-22-15-10-3)43-62-50(57)39-45(31-23-16-11-4)32-24-17-12-5/h44-45H,8-43H2,1-7H3 |
| InChIKey | ZFYAZQKCGSFDCM-UHFFFAOYSA-N |
| XLogP | 12.29 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 882.32 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|