C49H89NO12 — CID 170176446
5-O-[2-[4-(dimethylamino)butanoyloxymethyl]-2-[(5-octoxy-5-oxopentanoyl)oxymethyl]-3-(2-pentylheptanoyloxy)propyl] 1-O-octyl pentanedioate (PubChem CID 170176446) has the molecular formula C49H89NO12 and a molecular weight of 884.25 g/mol. Its IUPAC name is 5-O-[2-[4-(dimethylamino)butanoyloxymethyl]-2-[(5-octoxy-5-oxopentanoyl)oxymethyl]-3-(2-pentylheptanoyloxy)propyl] 1-O-octyl pentanedioate.
| Compound Name | 5-O-[2-[4-(dimethylamino)butanoyloxymethyl]-2-[(5-octoxy-5-oxopentanoyl)oxymethyl]-3-(2-pentylheptanoyloxy)propyl] 1-O-octyl pentanedioate |
|---|---|
| PubChem CID | 170176446 |
| Molecular Formula | C49H89NO12 |
| Molecular Weight | 884.25 g/mol |
| Exact Mass | 883.64 |
| IUPAC Name | 5-O-[2-[4-(dimethylamino)butanoyloxymethyl]-2-[(5-octoxy-5-oxopentanoyl)oxymethyl]-3-(2-pentylheptanoyloxy)propyl] 1-O-octyl pentanedioate |
| SMILES | CCCCCCCCOC(=O)CCCC(=O)OCC(COC(=O)CCCC(=O)OCCCCCCCC)(COC(=O)CCCN(C)C)COC(=O)C(CCCCC)CCCCC |
| InChI | InChI=1S/C49H89NO12/c1-7-11-15-17-19-23-36-57-43(51)30-25-32-45(53)59-38-49(40-61-47(55)34-27-35-50(5)6,41-62-48(56)42(28-21-13-9-3)29-22-14-10-4)39-60-46(54)33-26-31-44(52)58-37-24-20-18-16-12-8-2/h42H,7-41H2,1-6H3 |
| InChIKey | HVELSSIIBUPUEG-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.25 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|