C55H101NO12 — CID 170176390
1-O-[2-[5-(dimethylamino)pentanoyloxymethyl]-2-(2-hexoxycarbonyloctanoyloxymethyl)-3-(3-pentyloctanoyloxy)propyl] 3-O-hexyl 2-hexylpropanedioate (PubChem CID 170176390) has the molecular formula C55H101NO12 and a molecular weight of 968.41 g/mol. Its IUPAC name is 1-O-[2-[5-(dimethylamino)pentanoyloxymethyl]-2-(2-hexoxycarbonyloctanoyloxymethyl)-3-(3-pentyloctanoyloxy)propyl] 3-O-hexyl 2-hexylpropanedioate.
| Compound Name | 1-O-[2-[5-(dimethylamino)pentanoyloxymethyl]-2-(2-hexoxycarbonyloctanoyloxymethyl)-3-(3-pentyloctanoyloxy)propyl] 3-O-hexyl 2-hexylpropanedioate |
|---|---|
| PubChem CID | 170176390 |
| Molecular Formula | C55H101NO12 |
| Molecular Weight | 968.41 g/mol |
| Exact Mass | 967.73 |
| IUPAC Name | 1-O-[2-[5-(dimethylamino)pentanoyloxymethyl]-2-(2-hexoxycarbonyloctanoyloxymethyl)-3-(3-pentyloctanoyloxy)propyl] 3-O-hexyl 2-hexylpropanedioate |
| SMILES | CCCCCCOC(=O)C(CCCCCC)C(=O)OCC(COC(=O)CCCCN(C)C)(COC(=O)CC(CCCCC)CCCCC)COC(=O)C(CCCCCC)C(=O)OCCCCCC |
| InChI | InChI=1S/C55H101NO12/c1-9-15-21-27-35-47(51(59)63-39-31-23-17-11-3)53(61)67-44-55(42-65-49(57)37-29-30-38-56(7)8,43-66-50(58)41-46(33-25-19-13-5)34-26-20-14-6)45-68-54(62)48(36-28-22-16-10-2)52(60)64-40-32-24-18-12-4/h46-48H,9-45H2,1-8H3 |
| InChIKey | AUFILSARVNYPKO-UHFFFAOYSA-N |
| XLogP | 12.46 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 968.41 |
| LogP ≤ 5 | 12.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|