C54H99NO12 — CID 176788618
6-O-[2-[4-(diethylamino)butanoyloxymethyl]-2-[(6-heptoxy-6-oxohexanoyl)oxymethyl]-3-(3-pentyldecanoyloxy)propyl] 1-O-heptyl hexanedioate (PubChem CID 176788618) has the molecular formula C54H99NO12 and a molecular weight of 954.38 g/mol. Its IUPAC name is 6-O-[2-[4-(diethylamino)butanoyloxymethyl]-2-[(6-heptoxy-6-oxohexanoyl)oxymethyl]-3-(3-pentyldecanoyloxy)propyl] 1-O-heptyl hexanedioate.
| Compound Name | 6-O-[2-[4-(diethylamino)butanoyloxymethyl]-2-[(6-heptoxy-6-oxohexanoyl)oxymethyl]-3-(3-pentyldecanoyloxy)propyl] 1-O-heptyl hexanedioate |
|---|---|
| PubChem CID | 176788618 |
| Molecular Formula | C54H99NO12 |
| Molecular Weight | 954.38 g/mol |
| Exact Mass | 953.72 |
| IUPAC Name | 6-O-[2-[4-(diethylamino)butanoyloxymethyl]-2-[(6-heptoxy-6-oxohexanoyl)oxymethyl]-3-(3-pentyldecanoyloxy)propyl] 1-O-heptyl hexanedioate |
| SMILES | CCCCCCCOC(=O)CCCCC(=O)OCC(COC(=O)CCCCC(=O)OCCCCCCC)(COC(=O)CCCN(CC)CC)COC(=O)CC(CCCCC)CCCCCCC |
| InChI | InChI=1S/C54H99NO12/c1-7-13-17-20-24-33-47(32-23-16-10-4)42-53(61)67-46-54(45-66-52(60)38-31-39-55(11-5)12-6,43-64-50(58)36-27-25-34-48(56)62-40-29-21-18-14-8-2)44-65-51(59)37-28-26-35-49(57)63-41-30-22-19-15-9-3/h47H,7-46H2,1-6H3 |
| InChIKey | CEQZHNWSIGMAOT-UHFFFAOYSA-N |
| XLogP | 12.36 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 67 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 954.38 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|