C61H111NO15 — CID 168955678
7-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(7-nonoxy-7-oxoheptanoyl)oxy-2-[(7-nonoxy-7-oxoheptanoyl)oxymethyl]propyl] 1-O-nonyl heptanedioate (PubChem CID 168955678) has the molecular formula C61H111NO15 and a molecular weight of 1098.55 g/mol. Its IUPAC name is 7-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(7-nonoxy-7-oxoheptanoyl)oxy-2-[(7-nonoxy-7-oxoheptanoyl)oxymethyl]propyl] 1-O-nonyl heptanedioate.
| Compound Name | 7-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(7-nonoxy-7-oxoheptanoyl)oxy-2-[(7-nonoxy-7-oxoheptanoyl)oxymethyl]propyl] 1-O-nonyl heptanedioate |
|---|---|
| PubChem CID | 168955678 |
| Molecular Formula | C61H111NO15 |
| Molecular Weight | 1098.55 g/mol |
| Exact Mass | 1097.80 |
| IUPAC Name | 7-O-[2-[3-(diethylamino)propoxycarbonyloxymethyl]-3-(7-nonoxy-7-oxoheptanoyl)oxy-2-[(7-nonoxy-7-oxoheptanoyl)oxymethyl]propyl] 1-O-nonyl heptanedioate |
| SMILES | CCCCCCCCCOC(=O)CCCCCC(=O)OCC(COC(=O)CCCCCC(=O)OCCCCCCCCC)(COC(=O)CCCCCC(=O)OCCCCCCCCC)COC(=O)OCCCN(CC)CC |
| InChI | InChI=1S/C61H111NO15/c1-6-11-14-17-20-23-35-46-70-54(63)39-29-26-32-42-57(66)74-50-61(53-77-60(69)73-49-38-45-62(9-4)10-5,51-75-58(67)43-33-27-30-40-55(64)71-47-36-24-21-18-15-12-7-2)52-76-59(68)44-34-28-31-41-56(65)72-48-37-25-22-19-16-13-8-3/h6-53H2,1-5H3 |
| InChIKey | KWSVLGRKEVXLRW-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 196.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 56 |
| Heavy Atoms | 77 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1098.55 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|